C16H13NO3S — CID 151350564
ethyl 4-oxo-2-phenyl-2H-thieno[2,3-b]pyridine-5-carboxylate (PubChem CID 151350564) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is ethyl 4-oxo-2-phenyl-2H-thieno[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-oxo-2-phenyl-2H-thieno[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 151350564 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | ethyl 4-oxo-2-phenyl-2H-thieno[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=CN=C2SC(c3ccccc3)C=C2C1=O |
| InChI | InChI=1S/C16H13NO3S/c1-2-20-16(19)12-9-17-15-11(14(12)18)8-13(21-15)10-6-4-3-5-7-10/h3-9,13H,2H2,1H3 |
| InChIKey | OMKCMOYPAOAZOW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|