C19H29NO4 — CID 151365686
2-tert-butyl-4-ethyl-3-pyrrolidin-1-yloxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 151365686) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-tert-butyl-4-ethyl-3-pyrrolidin-1-yloxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 2-tert-butyl-4-ethyl-3-pyrrolidin-1-yloxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 151365686 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-tert-butyl-4-ethyl-3-pyrrolidin-1-yloxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCC12C=CC(C1)C(C(=O)O)(C(C)(C)C)C2C(=O)ON1CCCC1 |
| InChI | InChI=1S/C19H29NO4/c1-5-18-9-8-13(12-18)19(16(22)23,17(2,3)4)14(18)15(21)24-20-10-6-7-11-20/h8-9,13-14H,5-7,10-12H2,1-4H3,(H,22,23) |
| InChIKey | OPJMBERRJXHJRL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|