C11H11NO6 — CID 15140313
dimethyl (1S,4R)-7-nitrobicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 15140313) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is dimethyl (1S,4R)-7-nitrobicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,4R)-7-nitrobicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15140313 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | dimethyl (1S,4R)-7-nitrobicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C=C[C@H]1C2[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO6/c1-17-10(13)7-5-3-4-6(9(5)12(15)16)8(7)11(14)18-2/h3-6,9H,1-2H3/t5-,6+,9? |
| InChIKey | NQRBMRHFEUEWIA-SFJPZXRQSA-N |
| XLogP | 0.09 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|