C18H26O5 — CID 151411151
ethyl 4-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]butanoate (PubChem CID 151411151) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is ethyl 4-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]butanoate.
| Compound Name | ethyl 4-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]butanoate |
|---|---|
| PubChem CID | 151411151 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl 4-[[(4S,5R)-5-[(1E,3E)-hexa-1,3-dien-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]butanoate |
| SMILES | C#C/C=C/C=C/[C@H]1OC(C)(C)O[C@H]1COCCCC(=O)OCC |
| InChI | InChI=1S/C18H26O5/c1-5-7-8-9-11-15-16(23-18(3,4)22-15)14-20-13-10-12-17(19)21-6-2/h1,7-9,11,15-16H,6,10,12-14H2,2-4H3/b8-7+,11-9+/t15-,16+/m1/s1 |
| InChIKey | OYOBOJQSZLQLFO-RHSDSDGOSA-N |
| XLogP | 2.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|