C9H14O5 — CID 151411804
1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-carboxylic acid (PubChem CID 151411804) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-carboxylic acid.
| Compound Name | 1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 151411804 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1,3-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran-5-carboxylic acid |
| SMILES | O=C(O)C1CCC2C(O)OC(O)C2C1 |
| InChI | InChI=1S/C9H14O5/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h4-6,8-9,12-13H,1-3H2,(H,10,11) |
| InChIKey | OYRHRQITAYWLCE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |