C19H28O4 — CID 15141452
(3R,6R)-6-(1-adamantyl)-3-cyclohexyl-1,2,4-trioxan-5-one (PubChem CID 15141452) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3R,6R)-6-(1-adamantyl)-3-cyclohexyl-1,2,4-trioxan-5-one.
| Compound Name | (3R,6R)-6-(1-adamantyl)-3-cyclohexyl-1,2,4-trioxan-5-one |
|---|---|
| PubChem CID | 15141452 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (3R,6R)-6-(1-adamantyl)-3-cyclohexyl-1,2,4-trioxan-5-one |
| SMILES | O=C1O[C@@H](C2CCCCC2)OO[C@@H]1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H28O4/c20-17-16(22-23-18(21-17)15-4-2-1-3-5-15)19-9-12-6-13(10-19)8-14(7-12)11-19/h12-16,18H,1-11H2/t12?,13?,14?,16-,18+,19?/m0/s1 |
| InChIKey | AUODNRHABRSZPG-UJQYFYSQSA-N |
| XLogP | 3.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|