C22H30O4 — CID 15141438
6-(1-adamantyl)spiro[1,2,4-trioxane-3,2'-adamantane]-5-one (PubChem CID 15141438) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 6-(1-adamantyl)spiro[1,2,4-trioxane-3,2'-adamantane]-5-one.
| Compound Name | 6-(1-adamantyl)spiro[1,2,4-trioxane-3,2'-adamantane]-5-one |
|---|---|
| PubChem CID | 15141438 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 6-(1-adamantyl)spiro[1,2,4-trioxane-3,2'-adamantane]-5-one |
| SMILES | O=C1OC2(OOC1C13CC4CC(CC(C4)C1)C3)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C22H30O4/c23-20-19(21-9-14-2-15(10-21)4-16(3-14)11-21)25-26-22(24-20)17-5-12-1-13(7-17)8-18(22)6-12/h12-19H,1-11H2 |
| InChIKey | WBFSOUXOKIQZOD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|