C13H22O3 — CID 158347322
2-cyclohexyl-5-ethyl-5-methyl-1,3-dioxan-4-one (PubChem CID 158347322) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-cyclohexyl-5-ethyl-5-methyl-1,3-dioxan-4-one.
| Compound Name | 2-cyclohexyl-5-ethyl-5-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 158347322 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2-cyclohexyl-5-ethyl-5-methyl-1,3-dioxan-4-one |
| SMILES | CCC1(C)COC(C2CCCCC2)OC1=O |
| InChI | InChI=1S/C13H22O3/c1-3-13(2)9-15-11(16-12(13)14)10-7-5-4-6-8-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | SFFMNPAYZNOUKM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |