C17H29NO2 — CID 57216227
2-cyclohexyl-5-methyl-4-pentyl-1,3-dioxane-5-carbonitrile (PubChem CID 57216227) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-4-pentyl-1,3-dioxane-5-carbonitrile.
| Compound Name | 2-cyclohexyl-5-methyl-4-pentyl-1,3-dioxane-5-carbonitrile |
|---|---|
| PubChem CID | 57216227 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-cyclohexyl-5-methyl-4-pentyl-1,3-dioxane-5-carbonitrile |
| SMILES | CCCCCC1OC(C2CCCCC2)OCC1(C)C#N |
| InChI | InChI=1S/C17H29NO2/c1-3-4-6-11-15-17(2,12-18)13-19-16(20-15)14-9-7-5-8-10-14/h14-16H,3-11,13H2,1-2H3 |
| InChIKey | VZZGYPLYJSXMHW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|