C7H3F3N2O2S2 — CID 151425173
2-hydroxysulfanyl-7-(trifluoromethyl)-5H-[1,3]thiazolo[4,5-c]pyridin-4-one (PubChem CID 151425173) has the molecular formula C7H3F3N2O2S2 and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-hydroxysulfanyl-7-(trifluoromethyl)-5H-[1,3]thiazolo[4,5-c]pyridin-4-one.
| Compound Name | 2-hydroxysulfanyl-7-(trifluoromethyl)-5H-[1,3]thiazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 151425173 |
| Molecular Formula | C7H3F3N2O2S2 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 2-hydroxysulfanyl-7-(trifluoromethyl)-5H-[1,3]thiazolo[4,5-c]pyridin-4-one |
| SMILES | O=c1[nH]cc(C(F)(F)F)c2sc(SO)nc12 |
| InChI | InChI=1S/C7H3F3N2O2S2/c8-7(9,10)2-1-11-5(13)3-4(2)15-6(12-3)16-14/h1,14H,(H,11,13) |
| InChIKey | PBJFDGKHAJBLPF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|