C8H3BrF3NOS — CID 73012527
2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 73012527) has the molecular formula C8H3BrF3NOS and a molecular weight of 298.08 g/mol. Its IUPAC name is 2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one.
| Compound Name | 2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 73012527 |
| Molecular Formula | C8H3BrF3NOS |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 296.91 |
| IUPAC Name | 2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1[nH]cc(C(F)(F)F)c2sc(Br)cc12 |
| InChI | InChI=1S/C8H3BrF3NOS/c9-5-1-3-6(15-5)4(8(10,11)12)2-13-7(3)14/h1-2H,(H,13,14) |
| InChIKey | UHOADJDNWGVZRN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |