C14H7Br3 — CID 151469472
1,9,10-tribromoanthracene (PubChem CID 151469472) has the molecular formula C14H7Br3 and a molecular weight of 414.92 g/mol. Its IUPAC name is 1,9,10-tribromoanthracene.
| Compound Name | 1,9,10-tribromoanthracene |
|---|---|
| PubChem CID | 151469472 |
| Molecular Formula | C14H7Br3 |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 411.81 |
| IUPAC Name | 1,9,10-tribromoanthracene |
| SMILES | Brc1c2ccccc2c(Br)c2c(Br)cccc12 |
| InChI | InChI=1S/C14H7Br3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H |
| InChIKey | PKDSCRDGUGRJHE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|