C10H5Br4NO — CID 157143740
O-(2,3,4,5-tetrabromonaphthalen-1-yl)hydroxylamine (PubChem CID 157143740) has the molecular formula C10H5Br4NO and a molecular weight of 474.77 g/mol. Its IUPAC name is O-(2,3,4,5-tetrabromonaphthalen-1-yl)hydroxylamine.
| Compound Name | O-(2,3,4,5-tetrabromonaphthalen-1-yl)hydroxylamine |
|---|---|
| PubChem CID | 157143740 |
| Molecular Formula | C10H5Br4NO |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 470.71 |
| IUPAC Name | O-(2,3,4,5-tetrabromonaphthalen-1-yl)hydroxylamine |
| SMILES | NOc1c(Br)c(Br)c(Br)c2c(Br)cccc12 |
| InChI | InChI=1S/C10H5Br4NO/c11-5-3-1-2-4-6(5)7(12)8(13)9(14)10(4)16-15/h1-3H,15H2 |
| InChIKey | CHDFPCUMJRCFCV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|