About 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline
4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline (PubChem CID 151486756) has the molecular formula C18H17ClN2OS
and a molecular weight of 344.87 g/mol. Its IUPAC name is 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline |
| PubChem CID | 151486756 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline |
| SMILES | Cc1cc(Oc2cc(Cc3ccc(Cl)cc3)ns2)c(C)cc1N |
| InChI | InChI=1S/C18H17ClN2OS/c1-11-8-17(12(2)7-16(11)20)22-18-10-15(21-23-18)9-13-3-5-14(19)6-4-13/h3-8,10H,9,20H2,1-2H3 |
| InChIKey | PNPSSDWMGUIQGV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline?
The IUPAC name of 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline (CID 151486756) is 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline.
What is the SMILES notation for 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline?
The canonical SMILES for 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline is Cc1cc(Oc2cc(Cc3ccc(Cl)cc3)ns2)c(C)cc1N.
What is the InChIKey of 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline?
The InChIKey is PNPSSDWMGUIQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2OS/c1-11-8-17(12(2)7-16(11)20)22-18-10-15(21-23-18)9-13-3-5-14(19)6-4-13/h3-8,10H,9,20H2,1-2H3.
What are the key properties of 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline?
4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline has a molecular weight of 344.87 g/mol, XLogP of 5.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[(4-chlorophenyl)methyl]-1,2-thiazol-5-yl]oxy]-2,5-dimethylaniline is sourced from PubChem (CID 151486756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).