C11H12N4O2S — CID 15149173
ethyl N-(3,4-dicyano-5-ethylsulfanyl-1H-pyrrol-2-yl)carbamate (PubChem CID 15149173) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is ethyl N-(3,4-dicyano-5-ethylsulfanyl-1H-pyrrol-2-yl)carbamate.
| Compound Name | ethyl N-(3,4-dicyano-5-ethylsulfanyl-1H-pyrrol-2-yl)carbamate |
|---|---|
| PubChem CID | 15149173 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl N-(3,4-dicyano-5-ethylsulfanyl-1H-pyrrol-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1[nH]c(SCC)c(C#N)c1C#N |
| InChI | InChI=1S/C11H12N4O2S/c1-3-17-11(16)15-9-7(5-12)8(6-13)10(14-9)18-4-2/h14H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | OBSVKWTXUYPQES-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |