C44H66N2O4S2 — CID 15149519
diethyl 2,5-bis(2-decylsulfanylanilino)cyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 15149519) has the molecular formula C44H66N2O4S2 and a molecular weight of 751.16 g/mol. Its IUPAC name is diethyl 2,5-bis(2-decylsulfanylanilino)cyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis(2-decylsulfanylanilino)cyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 15149519 |
| Molecular Formula | C44H66N2O4S2 |
| Molecular Weight | 751.16 g/mol |
| Exact Mass | 750.45 |
| IUPAC Name | diethyl 2,5-bis(2-decylsulfanylanilino)cyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCSc1ccccc1NC1=C(C(=O)OCC)CC(Nc2ccccc2SCCCCCCCCCC)=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C44H66N2O4S2/c1-5-9-11-13-15-17-19-25-31-51-41-29-23-21-27-37(41)45-39-33-36(44(48)50-8-4)40(34-35(39)43(47)49-7-3)46-38-28-22-24-30-42(38)52-32-26-20-18-16-14-12-10-6-2/h21-24,27-30,45-46H,5-20,25-26,31-34H2,1-4H3 |
| InChIKey | OEYBUKUDCYVLSY-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.16 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|