C22H28N2O3S — CID 169390755
ethyl 6-amino-5-cyano-4-(2-hexylsulfanylphenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390755) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-4-(2-hexylsulfanylphenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-4-(2-hexylsulfanylphenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390755 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 6-amino-5-cyano-4-(2-hexylsulfanylphenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCCCCCSc1ccccc1C1C(C#N)=C(N)OC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C22H28N2O3S/c1-4-6-7-10-13-28-18-12-9-8-11-16(18)20-17(14-23)21(24)27-15(3)19(20)22(25)26-5-2/h8-9,11-12,20H,4-7,10,13,24H2,1-3H3 |
| InChIKey | UCCRGKNHSYHYMK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|