C18H11F6N3O — CID 151495605
N-(difluoromethyl)-5-fluoro-1-methyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide (PubChem CID 151495605) has the molecular formula C18H11F6N3O and a molecular weight of 399.29 g/mol. Its IUPAC name is N-(difluoromethyl)-5-fluoro-1-methyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-(difluoromethyl)-5-fluoro-1-methyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 151495605 |
| Molecular Formula | C18H11F6N3O |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-(difluoromethyl)-5-fluoro-1-methyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)N(c2ccccc2-c2cc(F)c(F)c(F)c2)C(F)F)c1F |
| InChI | InChI=1S/C18H11F6N3O/c1-26-16(22)11(8-25-26)17(28)27(18(23)24)14-5-3-2-4-10(14)9-6-12(19)15(21)13(20)7-9/h2-8,18H,1H3 |
| InChIKey | PPIYKLIPOUFSDM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|