About 2-benzylidenefluorene
2-benzylidenefluorene (PubChem CID 151506521) has the molecular formula C20H14
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-benzylidenefluorene.
Molecular Properties
| Compound Name | 2-benzylidenefluorene |
| PubChem CID | 151506521 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-benzylidenefluorene |
| SMILES | C(c1ccccc1)=c1ccc2c(c1)C=c1ccccc1=2 |
| InChI | InChI=1S/C20H14/c1-2-6-15(7-3-1)12-16-10-11-20-18(13-16)14-17-8-4-5-9-19(17)20/h1-14H |
| InChIKey | PRNSISRFWRMNRM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-benzylidenefluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylidenefluorene?
The IUPAC name of 2-benzylidenefluorene (CID 151506521) is 2-benzylidenefluorene.
What is the SMILES notation for 2-benzylidenefluorene?
The canonical SMILES for 2-benzylidenefluorene is C(c1ccccc1)=c1ccc2c(c1)C=c1ccccc1=2.
What is the InChIKey of 2-benzylidenefluorene?
The InChIKey is PRNSISRFWRMNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14/c1-2-6-15(7-3-1)12-16-10-11-20-18(13-16)14-17-8-4-5-9-19(17)20/h1-14H.
What are the key properties of 2-benzylidenefluorene?
2-benzylidenefluorene has a molecular weight of 254.33 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylidenefluorene is sourced from PubChem (CID 151506521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).