C9H9BrN4 — CID 15152350
8-bromo-5-methylquinazoline-2,4-diamine (PubChem CID 15152350) has the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. Its IUPAC name is 8-bromo-5-methylquinazoline-2,4-diamine.
| Compound Name | 8-bromo-5-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 15152350 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 8-bromo-5-methylquinazoline-2,4-diamine |
| SMILES | Cc1ccc(Br)c2nc(N)nc(N)c12 |
| InChI | InChI=1S/C9H9BrN4/c1-4-2-3-5(10)7-6(4)8(11)14-9(12)13-7/h2-3H,1H3,(H4,11,12,13,14) |
| InChIKey | XVQRKEZSSCGJRX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |