methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate

C17H30O4 — CID 15153642

IUPACmethyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate
SMILESCOC(=O)CCCCCC1CC(C)(C)CC2(C1)OCCO2
InChIInChI=1S/C17H30O4/c1-16(2)11-14(7-5-4-6-8-15(18)19-3)12-17(13-16)20-9-10-21-17/h14H,4-13H2,1-3H3
InChIKeyROFYYRNPBDTATC-UHFFFAOYSA-N
MW298.42 g/mol
LogP3.68
Rot. Bonds6

About methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate

methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate (PubChem CID 15153642) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate.

Molecular Properties

Compound Namemethyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate
PubChem CID15153642
Molecular FormulaC17H30O4
Molecular Weight298.42 g/mol
Exact Mass298.21
IUPAC Namemethyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate
SMILESCOC(=O)CCCCCC1CC(C)(C)CC2(C1)OCCO2
InChIInChI=1S/C17H30O4/c1-16(2)11-14(7-5-4-6-8-15(18)19-3)12-17(13-16)20-9-10-21-17/h14H,4-13H2,1-3H3
InChIKeyROFYYRNPBDTATC-UHFFFAOYSA-N
XLogP3.68
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.42
LogP ≤ 53.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate?
The IUPAC name of methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate (CID 15153642) is methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate.
What is the SMILES notation for methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate?
The canonical SMILES for methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate is COC(=O)CCCCCC1CC(C)(C)CC2(C1)OCCO2.
What is the InChIKey of methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate?
The InChIKey is ROFYYRNPBDTATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O4/c1-16(2)11-14(7-5-4-6-8-15(18)19-3)12-17(13-16)20-9-10-21-17/h14H,4-13H2,1-3H3.
What are the key properties of methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate?
methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate has a molecular weight of 298.42 g/mol, XLogP of 3.68, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(7,7-dimethyl-1,4-dioxaspiro[4.5]decan-9-yl)hexanoate is sourced from PubChem (CID 15153642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).