C6H6F8O2 — CID 15155939
1,1,2,2-tetrafluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)ethoxy]ethane (PubChem CID 15155939) has the molecular formula C6H6F8O2 and a molecular weight of 262.10 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)ethoxy]ethane.
| Compound Name | 1,1,2,2-tetrafluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)ethoxy]ethane |
|---|---|
| PubChem CID | 15155939 |
| Molecular Formula | C6H6F8O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-[2-(1,1,2,2-tetrafluoroethoxy)ethoxy]ethane |
| SMILES | FC(F)C(F)(F)OCCOC(F)(F)C(F)F |
| InChI | InChI=1S/C6H6F8O2/c7-3(8)5(11,12)15-1-2-16-6(13,14)4(9)10/h3-4H,1-2H2 |
| InChIKey | WVRJJXQSRCWPNS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|