C14H15NO4 — CID 15157046
(2-oxo-3-phenyl-1,3-oxazolidin-4-yl)methyl 2-methylprop-2-enoate (PubChem CID 15157046) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (2-oxo-3-phenyl-1,3-oxazolidin-4-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (2-oxo-3-phenyl-1,3-oxazolidin-4-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 15157046 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2-oxo-3-phenyl-1,3-oxazolidin-4-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1COC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H15NO4/c1-10(2)13(16)18-8-12-9-19-14(17)15(12)11-6-4-3-5-7-11/h3-7,12H,1,8-9H2,2H3 |
| InChIKey | GWVUVRPQLBRYGF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|