C23H27N7 — CID 151585883
3-(2,6-dimethylphenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 151585883) has the molecular formula C23H27N7 and a molecular weight of 401.52 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 3-(2,6-dimethylphenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 151585883 |
| Molecular Formula | C23H27N7 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-methyl-6-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | Cc1cccc(C)c1C1(N)NN(C)c2nc(Nc3ccc4c(c3)CNCC4)ncc21 |
| InChI | InChI=1S/C23H27N7/c1-14-5-4-6-15(2)20(14)23(24)19-13-26-22(28-21(19)30(3)29-23)27-18-8-7-16-9-10-25-12-17(16)11-18/h4-8,11,13,25,29H,9-10,12,24H2,1-3H3,(H,26,27,28) |
| InChIKey | QHMAWWKGYCMYQG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |