C18H20N2 — CID 151588176
2-(2-phenylphenyl)-1,2-diazabicyclo[2.2.2]octane (PubChem CID 151588176) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(2-phenylphenyl)-1,2-diazabicyclo[2.2.2]octane.
| Compound Name | 2-(2-phenylphenyl)-1,2-diazabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 151588176 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-(2-phenylphenyl)-1,2-diazabicyclo[2.2.2]octane |
| SMILES | c1ccc(-c2ccccc2N2CC3CCN2CC3)cc1 |
| InChI | InChI=1S/C18H20N2/c1-2-6-16(7-3-1)17-8-4-5-9-18(17)20-14-15-10-12-19(20)13-11-15/h1-9,15H,10-14H2 |
| InChIKey | QHXZIDNPSAWXKS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |