About dimethylsilyl 2-propyldec-7-enoate
dimethylsilyl 2-propyldec-7-enoate (PubChem CID 151592091) has the molecular formula C15H30O2Si
and a molecular weight of 270.49 g/mol. Its IUPAC name is dimethylsilyl 2-propyldec-7-enoate.
Molecular Properties
| Compound Name | dimethylsilyl 2-propyldec-7-enoate |
| PubChem CID | 151592091 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | dimethylsilyl 2-propyldec-7-enoate |
| SMILES | CCC=CCCCCC(CCC)C(=O)O[SiH](C)C |
| InChI | InChI=1S/C15H30O2Si/c1-5-7-8-9-10-11-13-14(12-6-2)15(16)17-18(3)4/h7-8,14,18H,5-6,9-13H2,1-4H3 |
| InChIKey | QISAWLLUVGCKDJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilyl 2-propyldec-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilyl 2-propyldec-7-enoate?
The IUPAC name of dimethylsilyl 2-propyldec-7-enoate (CID 151592091) is dimethylsilyl 2-propyldec-7-enoate.
What is the SMILES notation for dimethylsilyl 2-propyldec-7-enoate?
The canonical SMILES for dimethylsilyl 2-propyldec-7-enoate is CCC=CCCCCC(CCC)C(=O)O[SiH](C)C.
What is the InChIKey of dimethylsilyl 2-propyldec-7-enoate?
The InChIKey is QISAWLLUVGCKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2Si/c1-5-7-8-9-10-11-13-14(12-6-2)15(16)17-18(3)4/h7-8,14,18H,5-6,9-13H2,1-4H3.
What are the key properties of dimethylsilyl 2-propyldec-7-enoate?
dimethylsilyl 2-propyldec-7-enoate has a molecular weight of 270.49 g/mol, XLogP of 4.46, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilyl 2-propyldec-7-enoate is sourced from PubChem (CID 151592091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).