C20H21F3N3O- — CID 151604573
3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzenecarboximidate (PubChem CID 151604573) has the molecular formula C20H21F3N3O- and a molecular weight of 376.40 g/mol. Its IUPAC name is 3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzenecarboximidate.
| Compound Name | 3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 151604573 |
| Molecular Formula | C20H21F3N3O- |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzenecarboximidate |
| SMILES | [H]/N=C(\[O-])c1cccc(-c2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H22F3N3O/c1-25-7-9-26(10-8-25)13-17-6-5-15(12-18(17)20(21,22)23)14-3-2-4-16(11-14)19(24)27/h2-6,11-12H,7-10,13H2,1H3,(H2,24,27)/p-1 |
| InChIKey | QLEVQHMBNRWXLE-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|