C26H31N5O4S — CID 151605668
tert-butyl 3-(5-benzylsulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-4-methylpiperidine-1-carboxylate (PubChem CID 151605668) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is tert-butyl 3-(5-benzylsulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-benzylsulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 151605668 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | tert-butyl 3-(5-benzylsulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-4-methylpiperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)CC1c1ncc2cnc3c(ccn3S(=O)(=O)Cc3ccccc3)n12 |
| InChI | InChI=1S/C26H31N5O4S/c1-18-10-12-29(25(32)35-26(2,3)4)16-21(18)23-27-14-20-15-28-24-22(31(20)23)11-13-30(24)36(33,34)17-19-8-6-5-7-9-19/h5-9,11,13-15,18,21H,10,12,16-17H2,1-4H3 |
| InChIKey | QLKJWNFEFIPVGV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |