C20H21N3O5 — CID 151612755
2-[[4-[2-(1H-imidazol-2-yl)-2-oxoethoxy]phenyl]methylidene]-1-morpholin-4-ylbutane-1,3-dione (PubChem CID 151612755) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[[4-[2-(1H-imidazol-2-yl)-2-oxoethoxy]phenyl]methylidene]-1-morpholin-4-ylbutane-1,3-dione.
| Compound Name | 2-[[4-[2-(1H-imidazol-2-yl)-2-oxoethoxy]phenyl]methylidene]-1-morpholin-4-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 151612755 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[4-[2-(1H-imidazol-2-yl)-2-oxoethoxy]phenyl]methylidene]-1-morpholin-4-ylbutane-1,3-dione |
| SMILES | CC(=O)C(=Cc1ccc(OCC(=O)c2ncc[nH]2)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H21N3O5/c1-14(24)17(20(26)23-8-10-27-11-9-23)12-15-2-4-16(5-3-15)28-13-18(25)19-21-6-7-22-19/h2-7,12H,8-11,13H2,1H3,(H,21,22) |
| InChIKey | QMVWUJUPTHNCNU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|