C25H25N3O5 — CID 151613547
benzyl 2-[3-(2-hydroxy-3-methoxycarbonylanilino)-2-pyridinyl]pyrrolidine-1-carboxylate (PubChem CID 151613547) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is benzyl 2-[3-(2-hydroxy-3-methoxycarbonylanilino)-2-pyridinyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[3-(2-hydroxy-3-methoxycarbonylanilino)-2-pyridinyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151613547 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | benzyl 2-[3-(2-hydroxy-3-methoxycarbonylanilino)-2-pyridinyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1cccc(Nc2cccnc2C2CCCN2C(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C25H25N3O5/c1-32-24(30)18-10-5-11-20(23(18)29)27-19-12-6-14-26-22(19)21-13-7-15-28(21)25(31)33-16-17-8-3-2-4-9-17/h2-6,8-12,14,21,27,29H,7,13,15-16H2,1H3 |
| InChIKey | QMZVSDSKVQVTFV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|