C21H28N2O3 — CID 15161606
2-[(2S,12bS)-9-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]butyl acetate (PubChem CID 15161606) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[(2S,12bS)-9-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]butyl acetate.
| Compound Name | 2-[(2S,12bS)-9-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]butyl acetate |
|---|---|
| PubChem CID | 15161606 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-[(2S,12bS)-9-hydroxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]butyl acetate |
| SMILES | CCC(COC(C)=O)[C@H]1CCN2CCc3c([nH]c4ccc(O)cc34)[C@@H]2C1 |
| InChI | InChI=1S/C21H28N2O3/c1-3-14(12-26-13(2)24)15-6-8-23-9-7-17-18-11-16(25)4-5-19(18)22-21(17)20(23)10-15/h4-5,11,14-15,20,22,25H,3,6-10,12H2,1-2H3/t14?,15-,20-/m0/s1 |
| InChIKey | VSYRWPSENURDKW-NEYBVYDXSA-N |
| XLogP | 3.77 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|