C28H44N4O16 — CID 151642240
3-[(2S,5S,8S,11S)-5,8,11-tris(2-carboxyethyl)-1,4,7,10-tetrakis(carboxymethyl)-1,4,7,10-tetrazacyclododec-2-yl]propanoic acid (PubChem CID 151642240) has the molecular formula C28H44N4O16 and a molecular weight of 692.67 g/mol. Its IUPAC name is 3-[(2S,5S,8S,11S)-5,8,11-tris(2-carboxyethyl)-1,4,7,10-tetrakis(carboxymethyl)-1,4,7,10-tetrazacyclododec-2-yl]propanoic acid.
| Compound Name | 3-[(2S,5S,8S,11S)-5,8,11-tris(2-carboxyethyl)-1,4,7,10-tetrakis(carboxymethyl)-1,4,7,10-tetrazacyclododec-2-yl]propanoic acid |
|---|---|
| PubChem CID | 151642240 |
| Molecular Formula | C28H44N4O16 |
| Molecular Weight | 692.67 g/mol |
| Exact Mass | 692.28 |
| IUPAC Name | 3-[(2S,5S,8S,11S)-5,8,11-tris(2-carboxyethyl)-1,4,7,10-tetrakis(carboxymethyl)-1,4,7,10-tetrazacyclododec-2-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1CN(CC(=O)O)[C@@H](CCC(=O)O)CN(CC(=O)O)[C@@H](CCC(=O)O)CN(CC(=O)O)[C@@H](CCC(=O)O)CN1CC(=O)O |
| InChI | InChI=1S/C28H44N4O16/c33-21(34)5-1-17-9-30(14-26(43)44)19(3-7-23(37)38)11-32(16-28(47)48)20(4-8-24(39)40)12-31(15-27(45)46)18(2-6-22(35)36)10-29(17)13-25(41)42/h17-20H,1-16H2,(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | QSTRWJYKDLDRRD-MUGJNUQGSA-N |
| XLogP | -1.52 |
| TPSA | 311.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.67 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |