C25H51NO2Sn — CID 15164410
tert-butyl N-[cyclohexyl(tributylstannyl)methyl]-N-methylcarbamate (PubChem CID 15164410) has the molecular formula C25H51NO2Sn and a molecular weight of 516.40 g/mol. Its IUPAC name is tert-butyl N-[cyclohexyl(tributylstannyl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[cyclohexyl(tributylstannyl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 15164410 |
| Molecular Formula | C25H51NO2Sn |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | tert-butyl N-[cyclohexyl(tributylstannyl)methyl]-N-methylcarbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(C1CCCCC1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24NO2.3C4H9.Sn/c1-13(2,3)16-12(15)14(4)10-11-8-6-5-7-9-11;3*1-3-4-2;/h10-11H,5-9H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | DEIMAGCGTYUBBY-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |