C25H52OSn — CID 177418456
(1R,3S)-1-cyclohexyl-4,4-dimethyl-3-tributylstannylpentan-1-ol (PubChem CID 177418456) has the molecular formula C25H52OSn and a molecular weight of 487.40 g/mol. Its IUPAC name is (1R,3S)-1-cyclohexyl-4,4-dimethyl-3-tributylstannylpentan-1-ol.
| Compound Name | (1R,3S)-1-cyclohexyl-4,4-dimethyl-3-tributylstannylpentan-1-ol |
|---|---|
| PubChem CID | 177418456 |
| Molecular Formula | C25H52OSn |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (1R,3S)-1-cyclohexyl-4,4-dimethyl-3-tributylstannylpentan-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H](C[C@@H](O)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C13H25O.3C4H9.Sn/c1-13(2,3)10-9-12(14)11-7-5-4-6-8-11;3*1-3-4-2;/h10-12,14H,4-9H2,1-3H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1 |
| InChIKey | ZROIAAJMLHBEKZ-HHUWXINPSA-N |
| XLogP | 8.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |