C45H38ClNO6 — CID 151699842
3-[4-[(2-chlorophenyl)-diphenylmethoxy]-3-methoxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid (PubChem CID 151699842) has the molecular formula C45H38ClNO6 and a molecular weight of 724.25 g/mol. Its IUPAC name is 3-[4-[(2-chlorophenyl)-diphenylmethoxy]-3-methoxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid.
| Compound Name | 3-[4-[(2-chlorophenyl)-diphenylmethoxy]-3-methoxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 151699842 |
| Molecular Formula | C45H38ClNO6 |
| Molecular Weight | 724.25 g/mol |
| Exact Mass | 723.24 |
| IUPAC Name | 3-[4-[(2-chlorophenyl)-diphenylmethoxy]-3-methoxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
| SMILES | COc1cc(CC(C)(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)ccc1OC(c1ccccc1)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C45H38ClNO6/c1-44(42(48)49,47-43(50)52-29-37-35-21-11-9-19-33(35)34-20-10-12-22-36(34)37)28-30-25-26-40(41(27-30)51-2)53-45(31-15-5-3-6-16-31,32-17-7-4-8-18-32)38-23-13-14-24-39(38)46/h3-27,37H,28-29H2,1-2H3,(H,47,50)(H,48,49) |
| InChIKey | REISAHOJZYWELL-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.25 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|