C34H46O3 — CID 151715132
1-[1,1-bis(4-methylphenoxy)-2-propyldecoxy]-4-methylbenzene (PubChem CID 151715132) has the molecular formula C34H46O3 and a molecular weight of 502.74 g/mol. Its IUPAC name is 1-[1,1-bis(4-methylphenoxy)-2-propyldecoxy]-4-methylbenzene.
| Compound Name | 1-[1,1-bis(4-methylphenoxy)-2-propyldecoxy]-4-methylbenzene |
|---|---|
| PubChem CID | 151715132 |
| Molecular Formula | C34H46O3 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 1-[1,1-bis(4-methylphenoxy)-2-propyldecoxy]-4-methylbenzene |
| SMILES | CCCCCCCCC(CCC)C(Oc1ccc(C)cc1)(Oc1ccc(C)cc1)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C34H46O3/c1-6-8-9-10-11-12-14-30(13-7-2)34(35-31-21-15-27(3)16-22-31,36-32-23-17-28(4)18-24-32)37-33-25-19-29(5)20-26-33/h15-26,30H,6-14H2,1-5H3 |
| InChIKey | RHJWTJJHGYMGIV-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|