C21H30N6O3S — CID 15172481
(2S)-2-amino-5-(diaminomethylideneamino)-N-(5-piperidin-1-ylsulfonylnaphthalen-2-yl)pentanamide (PubChem CID 15172481) has the molecular formula C21H30N6O3S and a molecular weight of 446.58 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-(5-piperidin-1-ylsulfonylnaphthalen-2-yl)pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(5-piperidin-1-ylsulfonylnaphthalen-2-yl)pentanamide |
|---|---|
| PubChem CID | 15172481 |
| Molecular Formula | C21H30N6O3S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(5-piperidin-1-ylsulfonylnaphthalen-2-yl)pentanamide |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Nc1ccc2c(S(=O)(=O)N3CCCCC3)cccc2c1 |
| InChI | InChI=1S/C21H30N6O3S/c22-18(7-5-11-25-21(23)24)20(28)26-16-9-10-17-15(14-16)6-4-8-19(17)31(29,30)27-12-2-1-3-13-27/h4,6,8-10,14,18H,1-3,5,7,11-13,22H2,(H,26,28)(H4,23,24,25)/t18-/m0/s1 |
| InChIKey | XRTBQWQQJHQGHU-SFHVURJKSA-N |
| XLogP | 1.33 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|