C23H26ClNO2 — CID 151731311
(4-chlorophenyl)-[4-[(1-cyclopentylpyrrolidin-2-yl)methoxy]phenyl]methanone (PubChem CID 151731311) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is (4-chlorophenyl)-[4-[(1-cyclopentylpyrrolidin-2-yl)methoxy]phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[4-[(1-cyclopentylpyrrolidin-2-yl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 151731311 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (4-chlorophenyl)-[4-[(1-cyclopentylpyrrolidin-2-yl)methoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(OCC2CCCN2C2CCCC2)cc1 |
| InChI | InChI=1S/C23H26ClNO2/c24-19-11-7-17(8-12-19)23(26)18-9-13-22(14-10-18)27-16-21-6-3-15-25(21)20-4-1-2-5-20/h7-14,20-21H,1-6,15-16H2 |
| InChIKey | RKPQVTFHWWLRAA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |