C17H29N — CID 15173162
N-[1-methyl-4-[(2E,4E)-7-methylocta-2,4-dien-2-yl]cyclohexyl]methanimine (PubChem CID 15173162) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is N-[1-methyl-4-[(2E,4E)-7-methylocta-2,4-dien-2-yl]cyclohexyl]methanimine.
| Compound Name | N-[1-methyl-4-[(2E,4E)-7-methylocta-2,4-dien-2-yl]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 15173162 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-[1-methyl-4-[(2E,4E)-7-methylocta-2,4-dien-2-yl]cyclohexyl]methanimine |
| SMILES | C=NC1(C)CCC(/C(C)=C/C=C/CC(C)C)CC1 |
| InChI | InChI=1S/C17H29N/c1-14(2)8-6-7-9-15(3)16-10-12-17(4,18-5)13-11-16/h6-7,9,14,16H,5,8,10-13H2,1-4H3/b7-6+,15-9+ |
| InChIKey | FCNOQRBYKGOJJO-YSLZEPIFSA-N |
| XLogP | 5.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|