About 2-hydrazinylacetyl chloride
2-hydrazinylacetyl chloride (PubChem CID 151739181) has the molecular formula C2H5ClN2O
and a molecular weight of 108.53 g/mol. Its IUPAC name is 2-hydrazinylacetyl chloride.
Molecular Properties
| Compound Name | 2-hydrazinylacetyl chloride |
| PubChem CID | 151739181 |
| Molecular Formula | C2H5ClN2O |
| Molecular Weight | 108.53 g/mol |
| Exact Mass | 108.01 |
| IUPAC Name | 2-hydrazinylacetyl chloride |
| SMILES | NNCC(=O)Cl |
| InChI | InChI=1S/C2H5ClN2O/c3-2(6)1-5-4/h5H,1,4H2 |
| InChIKey | RMDZDMMXKMOQQZ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.53 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinylacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinylacetyl chloride?
The IUPAC name of 2-hydrazinylacetyl chloride (CID 151739181) is 2-hydrazinylacetyl chloride.
What is the SMILES notation for 2-hydrazinylacetyl chloride?
The canonical SMILES for 2-hydrazinylacetyl chloride is NNCC(=O)Cl.
What is the InChIKey of 2-hydrazinylacetyl chloride?
The InChIKey is RMDZDMMXKMOQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5ClN2O/c3-2(6)1-5-4/h5H,1,4H2.
What are the key properties of 2-hydrazinylacetyl chloride?
2-hydrazinylacetyl chloride has a molecular weight of 108.53 g/mol, XLogP of -0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinylacetyl chloride is sourced from PubChem (CID 151739181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).