C11H16BNO7S — CID 151739771
[4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenoxy]boronic acid (PubChem CID 151739771) has the molecular formula C11H16BNO7S and a molecular weight of 317.13 g/mol. Its IUPAC name is [4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenoxy]boronic acid.
| Compound Name | [4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenoxy]boronic acid |
|---|---|
| PubChem CID | 151739771 |
| Molecular Formula | C11H16BNO7S |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | [4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenoxy]boronic acid |
| SMILES | CC(C)Oc1cc(OB(O)O)ccc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C11H16BNO7S/c1-7(2)19-10-6-8(20-12(15)16)4-5-9(10)11(14)13-21(3,17)18/h4-7,15-16H,1-3H3,(H,13,14) |
| InChIKey | RMHAXORNYCQTQQ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|