C11H16BNO6S — CID 69103532
[4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenyl]boronic acid (PubChem CID 69103532) has the molecular formula C11H16BNO6S and a molecular weight of 301.13 g/mol. Its IUPAC name is [4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenyl]boronic acid.
| Compound Name | [4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenyl]boronic acid |
|---|---|
| PubChem CID | 69103532 |
| Molecular Formula | C11H16BNO6S |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [4-(methylsulfonylcarbamoyl)-3-propan-2-yloxyphenyl]boronic acid |
| SMILES | CC(C)Oc1cc(B(O)O)ccc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C11H16BNO6S/c1-7(2)19-10-6-8(12(15)16)4-5-9(10)11(14)13-20(3,17)18/h4-7,15-16H,1-3H3,(H,13,14) |
| InChIKey | MHDMXRMOVJCERM-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|