C10H12ClN3O2S — CID 151742069
3-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethyl)-1,3-thiazolidine (PubChem CID 151742069) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethyl)-1,3-thiazolidine.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 151742069 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-2-(nitromethyl)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])CC1SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H12ClN3O2S/c11-9-2-1-8(5-12-9)6-13-3-4-17-10(13)7-14(15)16/h1-2,5,10H,3-4,6-7H2 |
| InChIKey | RMTAXJVZADFAGG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|