C10H14ClN5O3 — CID 58064078
N-[3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,3,5-oxadiazinan-4-yl]nitramide (PubChem CID 58064078) has the molecular formula C10H14ClN5O3 and a molecular weight of 287.71 g/mol. Its IUPAC name is N-[3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,3,5-oxadiazinan-4-yl]nitramide.
| Compound Name | N-[3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,3,5-oxadiazinan-4-yl]nitramide |
|---|---|
| PubChem CID | 58064078 |
| Molecular Formula | C10H14ClN5O3 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[3-[(6-chloro-3-pyridinyl)methyl]-5-methyl-1,3,5-oxadiazinan-4-yl]nitramide |
| SMILES | CN1COCN(Cc2ccc(Cl)nc2)C1N[N+](=O)[O-] |
| InChI | InChI=1S/C10H14ClN5O3/c1-14-6-19-7-15(10(14)13-16(17)18)5-8-2-3-9(11)12-4-8/h2-4,10,13H,5-7H2,1H3 |
| InChIKey | MHVQQMYFYLYZQS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|