C13H23ClN6O2 — CID 21251678
1-[(6-chloro-3-pyridinyl)methyl]-3-nitro-5-propyl-1,3,5-triazinane;methanamine (PubChem CID 21251678) has the molecular formula C13H23ClN6O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-nitro-5-propyl-1,3,5-triazinane;methanamine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-nitro-5-propyl-1,3,5-triazinane;methanamine |
|---|---|
| PubChem CID | 21251678 |
| Molecular Formula | C13H23ClN6O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-nitro-5-propyl-1,3,5-triazinane;methanamine |
| SMILES | CCCN1CN(Cc2ccc(Cl)nc2)CN([N+](=O)[O-])C1.CN |
| InChI | InChI=1S/C12H18ClN5O2.CH5N/c1-2-5-15-8-16(10-17(9-15)18(19)20)7-11-3-4-12(13)14-6-11;1-2/h3-4,6H,2,5,7-10H2,1H3;2H2,1H3 |
| InChIKey | UJZSGAKYUITJNK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|