C16H21N — CID 151759391
4-[(1-butylcyclohexa-2,4-dien-1-yl)methyl]pyridine (PubChem CID 151759391) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-[(1-butylcyclohexa-2,4-dien-1-yl)methyl]pyridine.
| Compound Name | 4-[(1-butylcyclohexa-2,4-dien-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 151759391 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4-[(1-butylcyclohexa-2,4-dien-1-yl)methyl]pyridine |
| SMILES | CCCCC1(Cc2ccncc2)C=CC=CC1 |
| InChI | InChI=1S/C16H21N/c1-2-3-9-16(10-5-4-6-11-16)14-15-7-12-17-13-8-15/h4-8,10,12-13H,2-3,9,11,14H2,1H3 |
| InChIKey | RQFVYTGYQCKCSC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |