C18H27Cl3SiTi — CID 159874355
(3-butylcyclopenta-2,4-dien-1-yl)-(1-propylcyclohexa-2,4-dien-1-yl)silane;titanium(4+);trichloride (PubChem CID 159874355) has the molecular formula C18H27Cl3SiTi and a molecular weight of 425.73 g/mol. Its IUPAC name is (3-butylcyclopenta-2,4-dien-1-yl)-(1-propylcyclohexa-2,4-dien-1-yl)silane;titanium(4+);trichloride.
| Compound Name | (3-butylcyclopenta-2,4-dien-1-yl)-(1-propylcyclohexa-2,4-dien-1-yl)silane;titanium(4+);trichloride |
|---|---|
| PubChem CID | 159874355 |
| Molecular Formula | C18H27Cl3SiTi |
| Molecular Weight | 425.73 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | (3-butylcyclopenta-2,4-dien-1-yl)-(1-propylcyclohexa-2,4-dien-1-yl)silane;titanium(4+);trichloride |
| SMILES | CCCCc1cc[c-]([SiH2]C2(CCC)C=CC=CC2)c1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C18H27Si.3ClH.Ti/c1-3-5-9-16-10-11-17(15-16)19-18(12-4-2)13-7-6-8-14-18;;;;/h6-8,10-11,13,15H,3-5,9,12,14,19H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | UVNVNDQSFUNUKR-UHFFFAOYSA-K |
| XLogP | -4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.73 |
| LogP ≤ 5 | -4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|