C20H32Si — CID 152546848
(1-pentylcyclohexa-2,4-dien-1-yl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 152546848) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is (1-pentylcyclohexa-2,4-dien-1-yl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | (1-pentylcyclohexa-2,4-dien-1-yl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 152546848 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (1-pentylcyclohexa-2,4-dien-1-yl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCCCCC1([SiH2]C2=C(C)C(C)=C(C)C2C)C=CC=CC1 |
| InChI | InChI=1S/C20H32Si/c1-6-7-9-12-20(13-10-8-11-14-20)21-19-17(4)15(2)16(3)18(19)5/h8,10-11,13,17H,6-7,9,12,14,21H2,1-5H3 |
| InChIKey | YMQWCVBYDMGXHF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|