C20H31Cl3SiTi — CID 160600525
[1-(2-methylbutyl)cyclohexa-2,4-dien-1-yl]-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride (PubChem CID 160600525) has the molecular formula C20H31Cl3SiTi and a molecular weight of 453.78 g/mol. Its IUPAC name is [1-(2-methylbutyl)cyclohexa-2,4-dien-1-yl]-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride.
| Compound Name | [1-(2-methylbutyl)cyclohexa-2,4-dien-1-yl]-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride |
|---|---|
| PubChem CID | 160600525 |
| Molecular Formula | C20H31Cl3SiTi |
| Molecular Weight | 453.78 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [1-(2-methylbutyl)cyclohexa-2,4-dien-1-yl]-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane;titanium(4+);trichloride |
| SMILES | CCC(C)CC1([SiH2][c-]2c(C)c(C)c(C)c2C)C=CC=CC1.[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C20H31Si.3ClH.Ti/c1-7-14(2)13-20(11-9-8-10-12-20)21-19-17(5)15(3)16(4)18(19)6;;;;/h8-11,14H,7,12-13,21H2,1-6H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | CWGILXFPDMIEPF-UHFFFAOYSA-K |
| XLogP | -4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.78 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|