C16H20O2 — CID 174759641
3-butyl-2-(1-hydroxycyclohexa-2,4-dien-1-yl)phenol (PubChem CID 174759641) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 3-butyl-2-(1-hydroxycyclohexa-2,4-dien-1-yl)phenol.
| Compound Name | 3-butyl-2-(1-hydroxycyclohexa-2,4-dien-1-yl)phenol |
|---|---|
| PubChem CID | 174759641 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 3-butyl-2-(1-hydroxycyclohexa-2,4-dien-1-yl)phenol |
| SMILES | CCCCc1cccc(O)c1C1(O)C=CC=CC1 |
| InChI | InChI=1S/C16H20O2/c1-2-3-8-13-9-7-10-14(17)15(13)16(18)11-5-4-6-12-16/h4-7,9-11,17-18H,2-3,8,12H2,1H3 |
| InChIKey | WETKCVMGZUFVLV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |